C15H22N2O2 — CID 102603410
4-(methoxyiminomethyl)-N,N-dipropylbenzamide (PubChem CID 102603410) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-(methoxyiminomethyl)-N,N-dipropylbenzamide.
| Compound Name | 4-(methoxyiminomethyl)-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 102603410 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4-(methoxyiminomethyl)-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(C=NOC)cc1 |
| InChI | InChI=1S/C15H22N2O2/c1-4-10-17(11-5-2)15(18)14-8-6-13(7-9-14)12-16-19-3/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | IGTONMFHZFZPPZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|