C32H48N2O2 — CID 101349514
4-[(4-decoxyphenyl)iminomethyl]-N,N-bis(2-methylpropyl)benzamide (PubChem CID 101349514) has the molecular formula C32H48N2O2 and a molecular weight of 492.75 g/mol. Its IUPAC name is 4-[(4-decoxyphenyl)iminomethyl]-N,N-bis(2-methylpropyl)benzamide.
| Compound Name | 4-[(4-decoxyphenyl)iminomethyl]-N,N-bis(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 101349514 |
| Molecular Formula | C32H48N2O2 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.37 |
| IUPAC Name | 4-[(4-decoxyphenyl)iminomethyl]-N,N-bis(2-methylpropyl)benzamide |
| SMILES | CCCCCCCCCCOc1ccc(/N=C/c2ccc(C(=O)N(CC(C)C)CC(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H48N2O2/c1-6-7-8-9-10-11-12-13-22-36-31-20-18-30(19-21-31)33-23-28-14-16-29(17-15-28)32(35)34(24-26(2)3)25-27(4)5/h14-21,23,26-27H,6-13,22,24-25H2,1-5H3/b33-23+ |
| InChIKey | XYEDINNYAWSSFN-GZZLJNBRSA-N |
| XLogP | 8.71 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|