C22H30N4O4 — CID 145154252
(2S)-2-benzamido-3-(4-ethoxyphenyl)propanoic acid;2-propan-2-ylguanidine (PubChem CID 145154252) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2S)-2-benzamido-3-(4-ethoxyphenyl)propanoic acid;2-propan-2-ylguanidine.
| Compound Name | (2S)-2-benzamido-3-(4-ethoxyphenyl)propanoic acid;2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 145154252 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (2S)-2-benzamido-3-(4-ethoxyphenyl)propanoic acid;2-propan-2-ylguanidine |
| SMILES | CC(C)N=C(N)N.CCOc1ccc(C[C@H](NC(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C18H19NO4.C4H11N3/c1-2-23-15-10-8-13(9-11-15)12-16(18(21)22)19-17(20)14-6-4-3-5-7-14;1-3(2)7-4(5)6/h3-11,16H,2,12H2,1H3,(H,19,20)(H,21,22);3H,1-2H3,(H4,5,6,7)/t16-;/m0./s1 |
| InChIKey | PLLHDURLBKLTRG-NTISSMGPSA-N |
| XLogP | 2.18 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|