C22H27NO4 — CID 162115556
2-benzamido-3-[4-(2-oxobutyl)phenyl]propanoic acid;ethane (PubChem CID 162115556) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-benzamido-3-[4-(2-oxobutyl)phenyl]propanoic acid;ethane.
| Compound Name | 2-benzamido-3-[4-(2-oxobutyl)phenyl]propanoic acid;ethane |
|---|---|
| PubChem CID | 162115556 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-benzamido-3-[4-(2-oxobutyl)phenyl]propanoic acid;ethane |
| SMILES | CC.CCC(=O)Cc1ccc(CC(NC(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H21NO4.C2H6/c1-2-17(22)12-14-8-10-15(11-9-14)13-18(20(24)25)21-19(23)16-6-4-3-5-7-16;1-2/h3-11,18H,2,12-13H2,1H3,(H,21,23)(H,24,25);1-2H3 |
| InChIKey | ZGSGCNPJTWGIBV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |