C24H26N4O6 — CID 67717269
piperidin-4-yl (4S)-4-[(4-carbamimidoylbenzoyl)amino]-5-(4-hydroxyphenyl)-2,3-dioxopentanoate (PubChem CID 67717269) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is piperidin-4-yl (4S)-4-[(4-carbamimidoylbenzoyl)amino]-5-(4-hydroxyphenyl)-2,3-dioxopentanoate.
| Compound Name | piperidin-4-yl (4S)-4-[(4-carbamimidoylbenzoyl)amino]-5-(4-hydroxyphenyl)-2,3-dioxopentanoate |
|---|---|
| PubChem CID | 67717269 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | piperidin-4-yl (4S)-4-[(4-carbamimidoylbenzoyl)amino]-5-(4-hydroxyphenyl)-2,3-dioxopentanoate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)C(=O)C(=O)OC2CCNCC2)cc1 |
| InChI | InChI=1S/C24H26N4O6/c25-22(26)15-3-5-16(6-4-15)23(32)28-19(13-14-1-7-17(29)8-2-14)20(30)21(31)24(33)34-18-9-11-27-12-10-18/h1-8,18-19,27,29H,9-13H2,(H3,25,26)(H,28,32)/t19-/m0/s1 |
| InChIKey | IIAPPHJJLRBTBM-IBGZPJMESA-N |
| XLogP | 0.45 |
| TPSA | 171.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|