C25H31N3O6 — CID 67570229
(2S)-4-[[4-(aminomethyl)benzoyl]amino]-5-(4-methoxyphenyl)-3-oxo-2-piperidin-4-yloxypentanoic acid (PubChem CID 67570229) has the molecular formula C25H31N3O6 and a molecular weight of 469.54 g/mol. Its IUPAC name is (2S)-4-[[4-(aminomethyl)benzoyl]amino]-5-(4-methoxyphenyl)-3-oxo-2-piperidin-4-yloxypentanoic acid.
| Compound Name | (2S)-4-[[4-(aminomethyl)benzoyl]amino]-5-(4-methoxyphenyl)-3-oxo-2-piperidin-4-yloxypentanoic acid |
|---|---|
| PubChem CID | 67570229 |
| Molecular Formula | C25H31N3O6 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | (2S)-4-[[4-(aminomethyl)benzoyl]amino]-5-(4-methoxyphenyl)-3-oxo-2-piperidin-4-yloxypentanoic acid |
| SMILES | COc1ccc(CC(NC(=O)c2ccc(CN)cc2)C(=O)[C@H](OC2CCNCC2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H31N3O6/c1-33-19-8-4-16(5-9-19)14-21(28-24(30)18-6-2-17(15-26)3-7-18)22(29)23(25(31)32)34-20-10-12-27-13-11-20/h2-9,20-21,23,27H,10-15,26H2,1H3,(H,28,30)(H,31,32)/t21?,23-/m0/s1 |
| InChIKey | KQVUNBIKJWUJII-YANBTOMASA-N |
| XLogP | 1.29 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|