C17H25N5O3 — CID 67663041
N-[(2S)-4-amino-1-(4-hydroxypiperidin-1-yl)-1-oxobutan-2-yl]-4-carbamimidoylbenzamide (PubChem CID 67663041) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[(2S)-4-amino-1-(4-hydroxypiperidin-1-yl)-1-oxobutan-2-yl]-4-carbamimidoylbenzamide.
| Compound Name | N-[(2S)-4-amino-1-(4-hydroxypiperidin-1-yl)-1-oxobutan-2-yl]-4-carbamimidoylbenzamide |
|---|---|
| PubChem CID | 67663041 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[(2S)-4-amino-1-(4-hydroxypiperidin-1-yl)-1-oxobutan-2-yl]-4-carbamimidoylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@@H](CCN)C(=O)N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C17H25N5O3/c18-8-5-14(17(25)22-9-6-13(23)7-10-22)21-16(24)12-3-1-11(2-4-12)15(19)20/h1-4,13-14,23H,5-10,18H2,(H3,19,20)(H,21,24)/t14-/m0/s1 |
| InChIKey | VALGVDOEHFAQSJ-AWEZNQCLSA-N |
| XLogP | -0.60 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|