C27H34N4O4 — CID 22941985
2-[1-[(3R)-3-[(4-carbamimidoylbenzoyl)amino]-4-methyl-2-phenylpentanoyl]piperidin-4-yl]acetic acid (PubChem CID 22941985) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[1-[(3R)-3-[(4-carbamimidoylbenzoyl)amino]-4-methyl-2-phenylpentanoyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[(3R)-3-[(4-carbamimidoylbenzoyl)amino]-4-methyl-2-phenylpentanoyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22941985 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 2-[1-[(3R)-3-[(4-carbamimidoylbenzoyl)amino]-4-methyl-2-phenylpentanoyl]piperidin-4-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@H](C(C)C)C(C(=O)N2CCC(CC(=O)O)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H34N4O4/c1-17(2)24(30-26(34)21-10-8-20(9-11-21)25(28)29)23(19-6-4-3-5-7-19)27(35)31-14-12-18(13-15-31)16-22(32)33/h3-11,17-18,23-24H,12-16H2,1-2H3,(H3,28,29)(H,30,34)(H,32,33)/t23?,24-/m1/s1 |
| InChIKey | RFAHQOOXVWNMBE-XMMISQBUSA-N |
| XLogP | 3.22 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|