C27H33ClN4O4 — CID 10697113
methyl 2-[1-[3-[(4-carbamimidoylbenzoyl)amino]-3-(3-chlorophenyl)-2,2-dimethylpropanoyl]piperidin-4-yl]acetate (PubChem CID 10697113) has the molecular formula C27H33ClN4O4 and a molecular weight of 513.04 g/mol. Its IUPAC name is methyl 2-[1-[3-[(4-carbamimidoylbenzoyl)amino]-3-(3-chlorophenyl)-2,2-dimethylpropanoyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[3-[(4-carbamimidoylbenzoyl)amino]-3-(3-chlorophenyl)-2,2-dimethylpropanoyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 10697113 |
| Molecular Formula | C27H33ClN4O4 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | methyl 2-[1-[3-[(4-carbamimidoylbenzoyl)amino]-3-(3-chlorophenyl)-2,2-dimethylpropanoyl]piperidin-4-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NC(c2cccc(Cl)c2)C(C)(C)C(=O)N2CCC(CC(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C27H33ClN4O4/c1-27(2,26(35)32-13-11-17(12-14-32)15-22(33)36-3)23(20-5-4-6-21(28)16-20)31-25(34)19-9-7-18(8-10-19)24(29)30/h4-10,16-17,23H,11-15H2,1-3H3,(H3,29,30)(H,31,34) |
| InChIKey | DJOPWLJYPOBMJJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|