C23H33N3O5 — CID 170150281
methyl 4-[[(2S)-1-(4-hydroxypiperidin-1-yl)-5-[methyl(prop-2-enyl)amino]-1-oxopentan-2-yl]carbamoyl]benzoate (PubChem CID 170150281) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is methyl 4-[[(2S)-1-(4-hydroxypiperidin-1-yl)-5-[methyl(prop-2-enyl)amino]-1-oxopentan-2-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[(2S)-1-(4-hydroxypiperidin-1-yl)-5-[methyl(prop-2-enyl)amino]-1-oxopentan-2-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 170150281 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | methyl 4-[[(2S)-1-(4-hydroxypiperidin-1-yl)-5-[methyl(prop-2-enyl)amino]-1-oxopentan-2-yl]carbamoyl]benzoate |
| SMILES | C=CCN(C)CCC[C@H](NC(=O)c1ccc(C(=O)OC)cc1)C(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C23H33N3O5/c1-4-13-25(2)14-5-6-20(22(29)26-15-11-19(27)12-16-26)24-21(28)17-7-9-18(10-8-17)23(30)31-3/h4,7-10,19-20,27H,1,5-6,11-16H2,2-3H3,(H,24,28)/t20-/m0/s1 |
| InChIKey | SWKZDSKOCUZNIO-FQEVSTJZSA-N |
| XLogP | 1.45 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|