C25H34N6O2 — CID 155104897
N-[(2S)-1-(4-methylpiperazin-1-yl)-5-[methyl(prop-2-enyl)amino]-1-oxopentan-2-yl]-4-pyrimidin-2-ylbenzamide (PubChem CID 155104897) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is N-[(2S)-1-(4-methylpiperazin-1-yl)-5-[methyl(prop-2-enyl)amino]-1-oxopentan-2-yl]-4-pyrimidin-2-ylbenzamide.
| Compound Name | N-[(2S)-1-(4-methylpiperazin-1-yl)-5-[methyl(prop-2-enyl)amino]-1-oxopentan-2-yl]-4-pyrimidin-2-ylbenzamide |
|---|---|
| PubChem CID | 155104897 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | N-[(2S)-1-(4-methylpiperazin-1-yl)-5-[methyl(prop-2-enyl)amino]-1-oxopentan-2-yl]-4-pyrimidin-2-ylbenzamide |
| SMILES | C=CCN(C)CCC[C@H](NC(=O)c1ccc(-c2ncccn2)cc1)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H34N6O2/c1-4-14-29(2)15-5-7-22(25(33)31-18-16-30(3)17-19-31)28-24(32)21-10-8-20(9-11-21)23-26-12-6-13-27-23/h4,6,8-13,22H,1,5,7,14-19H2,2-3H3,(H,28,32)/t22-/m0/s1 |
| InChIKey | KHRPHFCIIMPYCP-QFIPXVFZSA-N |
| XLogP | 1.91 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|