C25H37N5O8 — CID 19691628
ethyl 2-[1-[5-(ethoxycarbonylamino)-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]pentanoyl]piperidin-4-yl]oxyacetate (PubChem CID 19691628) has the molecular formula C25H37N5O8 and a molecular weight of 535.60 g/mol. Its IUPAC name is ethyl 2-[1-[5-(ethoxycarbonylamino)-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]pentanoyl]piperidin-4-yl]oxyacetate.
| Compound Name | ethyl 2-[1-[5-(ethoxycarbonylamino)-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]pentanoyl]piperidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 19691628 |
| Molecular Formula | C25H37N5O8 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | ethyl 2-[1-[5-(ethoxycarbonylamino)-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]pentanoyl]piperidin-4-yl]oxyacetate |
| SMILES | CCOC(=O)COC1CCN(C(=O)C(CCCNC(=O)OCC)NC(=O)c2ccc(/C(N)=N/O)cc2)CC1 |
| InChI | InChI=1S/C25H37N5O8/c1-3-36-21(31)16-38-19-11-14-30(15-12-19)24(33)20(6-5-13-27-25(34)37-4-2)28-23(32)18-9-7-17(8-10-18)22(26)29-35/h7-10,19-20,35H,3-6,11-16H2,1-2H3,(H2,26,29)(H,27,34)(H,28,32) |
| InChIKey | KSOFCYJFMNWQDW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 181.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|