C21H28N4O6 — CID 87323966
ethyl 2-[1-[3-[6-[(Z)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]propanoyl]piperidin-4-yl]oxyacetate (PubChem CID 87323966) has the molecular formula C21H28N4O6 and a molecular weight of 432.48 g/mol. Its IUPAC name is ethyl 2-[1-[3-[6-[(Z)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]propanoyl]piperidin-4-yl]oxyacetate.
| Compound Name | ethyl 2-[1-[3-[6-[(Z)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]propanoyl]piperidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 87323966 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | ethyl 2-[1-[3-[6-[(Z)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]propanoyl]piperidin-4-yl]oxyacetate |
| SMILES | CCOC(=O)COC1CCN(C(=O)CCN2Cc3cc(/C(N)=N/O)ccc3C2=O)CC1 |
| InChI | InChI=1S/C21H28N4O6/c1-2-30-19(27)13-31-16-5-8-24(9-6-16)18(26)7-10-25-12-15-11-14(20(22)23-29)3-4-17(15)21(25)28/h3-4,11,16,29H,2,5-10,12-13H2,1H3,(H2,22,23) |
| InChIKey | RMZTXDQWKUXIKL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|