C25H29N3O10S2 — CID 11319343
ethyl 2-[2,6-bis(ethylsulfonyl)-4-[2-[6-[(E)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate (PubChem CID 11319343) has the molecular formula C25H29N3O10S2 and a molecular weight of 595.65 g/mol. Its IUPAC name is ethyl 2-[2,6-bis(ethylsulfonyl)-4-[2-[6-[(E)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-bis(ethylsulfonyl)-4-[2-[6-[(E)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
|---|---|
| PubChem CID | 11319343 |
| Molecular Formula | C25H29N3O10S2 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.13 |
| IUPAC Name | ethyl 2-[2,6-bis(ethylsulfonyl)-4-[2-[6-[(E)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(S(=O)(=O)CC)cc(C(=O)CN2Cc3cc(/C(N)=N\O)ccc3C2=O)cc1S(=O)(=O)CC |
| InChI | InChI=1S/C25H29N3O10S2/c1-4-37-22(30)14-38-23-20(39(33,34)5-2)10-16(11-21(23)40(35,36)6-3)19(29)13-28-12-17-9-15(24(26)27-32)7-8-18(17)25(28)31/h7-11,32H,4-6,12-14H2,1-3H3,(H2,26,27) |
| InChIKey | VCXYBKJBDYIKMA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 199.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|