C25H27N3O8 — CID 11466124
ethyl 2-[4-[2-(6-carbamimidoyl-3-oxo-1H-isoindol-2-yl)acetyl]-2-(2-ethoxy-2-oxoethoxy)phenoxy]acetate (PubChem CID 11466124) has the molecular formula C25H27N3O8 and a molecular weight of 497.50 g/mol. Its IUPAC name is ethyl 2-[4-[2-(6-carbamimidoyl-3-oxo-1H-isoindol-2-yl)acetyl]-2-(2-ethoxy-2-oxoethoxy)phenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-(6-carbamimidoyl-3-oxo-1H-isoindol-2-yl)acetyl]-2-(2-ethoxy-2-oxoethoxy)phenoxy]acetate |
|---|---|
| PubChem CID | 11466124 |
| Molecular Formula | C25H27N3O8 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | ethyl 2-[4-[2-(6-carbamimidoyl-3-oxo-1H-isoindol-2-yl)acetyl]-2-(2-ethoxy-2-oxoethoxy)phenoxy]acetate |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)CN(CC(=O)c1ccc(OCC(=O)OCC)c(OCC(=O)OCC)c1)C2=O |
| InChI | InChI=1S/C25H27N3O8/c1-3-33-22(30)13-35-20-8-6-15(10-21(20)36-14-23(31)34-4-2)19(29)12-28-11-17-9-16(24(26)27)5-7-18(17)25(28)32/h5-10H,3-4,11-14H2,1-2H3,(H3,26,27) |
| InChIKey | WFXSDRFYLIHEJT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|