C26H28N2O8S — CID 67246715
ethyl 2-[2-(2-ethoxy-2-oxoethoxy)-4-[2-[6-(C-methylsulfanylcarbonimidoyl)-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate (PubChem CID 67246715) has the molecular formula C26H28N2O8S and a molecular weight of 528.58 g/mol. Its IUPAC name is ethyl 2-[2-(2-ethoxy-2-oxoethoxy)-4-[2-[6-(C-methylsulfanylcarbonimidoyl)-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-(2-ethoxy-2-oxoethoxy)-4-[2-[6-(C-methylsulfanylcarbonimidoyl)-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
|---|---|
| PubChem CID | 67246715 |
| Molecular Formula | C26H28N2O8S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | ethyl 2-[2-(2-ethoxy-2-oxoethoxy)-4-[2-[6-(C-methylsulfanylcarbonimidoyl)-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
| SMILES | [H]/N=C(\SC)c1ccc2c(c1)CN(CC(=O)c1ccc(OCC(=O)OCC)c(OCC(=O)OCC)c1)C2=O |
| InChI | InChI=1S/C26H28N2O8S/c1-4-33-23(30)14-35-21-9-7-16(11-22(21)36-15-24(31)34-5-2)20(29)13-28-12-18-10-17(25(27)37-3)6-8-19(18)26(28)32/h6-11,27H,4-5,12-15H2,1-3H3/b27-25- |
| InChIKey | NGLCSOCJQQYFLD-RFBIWTDZSA-N |
| XLogP | 3.10 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|