C21H20ClN3O6 — CID 73096477
ethyl 2-[2-chloro-4-[2-[6-(N'-hydroxycarbamimidoyl)-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate (PubChem CID 73096477) has the molecular formula C21H20ClN3O6 and a molecular weight of 445.86 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[2-[6-(N'-hydroxycarbamimidoyl)-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[2-[6-(N'-hydroxycarbamimidoyl)-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
|---|---|
| PubChem CID | 73096477 |
| Molecular Formula | C21H20ClN3O6 |
| Molecular Weight | 445.86 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | ethyl 2-[2-chloro-4-[2-[6-(N'-hydroxycarbamimidoyl)-3-oxo-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(=O)CN2Cc3cc(C(N)=NO)ccc3C2=O)cc1Cl |
| InChI | InChI=1S/C21H20ClN3O6/c1-2-30-19(27)11-31-18-6-4-12(8-16(18)22)17(26)10-25-9-14-7-13(20(23)24-29)3-5-15(14)21(25)28/h3-8,29H,2,9-11H2,1H3,(H2,23,24) |
| InChIKey | LHPJICAXFSGAEP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.86 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|