C24H25N3O7 — CID 87323583
ethyl 2-[4-[2-[6-[(Z)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]acetyl]-3-prop-2-enoxyphenoxy]acetate (PubChem CID 87323583) has the molecular formula C24H25N3O7 and a molecular weight of 467.48 g/mol. Its IUPAC name is ethyl 2-[4-[2-[6-[(Z)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]acetyl]-3-prop-2-enoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-[6-[(Z)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]acetyl]-3-prop-2-enoxyphenoxy]acetate |
|---|---|
| PubChem CID | 87323583 |
| Molecular Formula | C24H25N3O7 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | ethyl 2-[4-[2-[6-[(Z)-N'-hydroxycarbamimidoyl]-3-oxo-1H-isoindol-2-yl]acetyl]-3-prop-2-enoxyphenoxy]acetate |
| SMILES | C=CCOc1cc(OCC(=O)OCC)ccc1C(=O)CN1Cc2cc(/C(N)=N/O)ccc2C1=O |
| InChI | InChI=1S/C24H25N3O7/c1-3-9-33-21-11-17(34-14-22(29)32-4-2)6-8-19(21)20(28)13-27-12-16-10-15(23(25)26-31)5-7-18(16)24(27)30/h3,5-8,10-11,31H,1,4,9,12-14H2,2H3,(H2,25,26) |
| InChIKey | GXOBSEFNDZMPAL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|