C22H22N2O8S — CID 91035343
ethyl 2-[3-hydroxy-5-methoxy-4-[2-[3-oxo-6-(sulfanylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]acetate (PubChem CID 91035343) has the molecular formula C22H22N2O8S and a molecular weight of 474.49 g/mol. Its IUPAC name is ethyl 2-[3-hydroxy-5-methoxy-4-[2-[3-oxo-6-(sulfanylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]acetate.
| Compound Name | ethyl 2-[3-hydroxy-5-methoxy-4-[2-[3-oxo-6-(sulfanylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
|---|---|
| PubChem CID | 91035343 |
| Molecular Formula | C22H22N2O8S |
| Molecular Weight | 474.49 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | ethyl 2-[3-hydroxy-5-methoxy-4-[2-[3-oxo-6-(sulfanylcarbamoyl)-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(O)c(C(=O)CN2Cc3cc(C(=O)NS)ccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O8S/c1-3-31-19(27)11-32-14-7-16(25)20(18(8-14)30-2)17(26)10-24-9-13-6-12(21(28)23-33)4-5-15(13)22(24)29/h4-8,25,33H,3,9-11H2,1-2H3,(H,23,28) |
| InChIKey | BPJIRHUSYKRSFG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|