C23H23N3O7 — CID 67246259
ethyl 2-[4-[2-[6-[(acetylhydrazinylidene)methyl]-3-oxo-1H-isoindol-2-yl]acetyl]-3-hydroxyphenoxy]acetate (PubChem CID 67246259) has the molecular formula C23H23N3O7 and a molecular weight of 453.45 g/mol. Its IUPAC name is ethyl 2-[4-[2-[6-[(acetylhydrazinylidene)methyl]-3-oxo-1H-isoindol-2-yl]acetyl]-3-hydroxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-[6-[(acetylhydrazinylidene)methyl]-3-oxo-1H-isoindol-2-yl]acetyl]-3-hydroxyphenoxy]acetate |
|---|---|
| PubChem CID | 67246259 |
| Molecular Formula | C23H23N3O7 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | ethyl 2-[4-[2-[6-[(acetylhydrazinylidene)methyl]-3-oxo-1H-isoindol-2-yl]acetyl]-3-hydroxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C(=O)CN2Cc3cc(C=NNC(C)=O)ccc3C2=O)c(O)c1 |
| InChI | InChI=1S/C23H23N3O7/c1-3-32-22(30)13-33-17-5-7-19(20(28)9-17)21(29)12-26-11-16-8-15(10-24-25-14(2)27)4-6-18(16)23(26)31/h4-10,28H,3,11-13H2,1-2H3,(H,25,27) |
| InChIKey | FZOKGTLQGWLUSK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|