C23H31N3O5 — CID 54563874
tert-butyl 2-[1-[(2S)-2-[(4-cyanobenzoyl)amino]butanoyl]piperidin-4-yl]oxyacetate (PubChem CID 54563874) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is tert-butyl 2-[1-[(2S)-2-[(4-cyanobenzoyl)amino]butanoyl]piperidin-4-yl]oxyacetate.
| Compound Name | tert-butyl 2-[1-[(2S)-2-[(4-cyanobenzoyl)amino]butanoyl]piperidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 54563874 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | tert-butyl 2-[1-[(2S)-2-[(4-cyanobenzoyl)amino]butanoyl]piperidin-4-yl]oxyacetate |
| SMILES | CC[C@H](NC(=O)c1ccc(C#N)cc1)C(=O)N1CCC(OCC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H31N3O5/c1-5-19(25-21(28)17-8-6-16(14-24)7-9-17)22(29)26-12-10-18(11-13-26)30-15-20(27)31-23(2,3)4/h6-9,18-19H,5,10-13,15H2,1-4H3,(H,25,28)/t19-/m0/s1 |
| InChIKey | ZSMCPOGOPXJMTM-IBGZPJMESA-N |
| XLogP | 2.42 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |