C25H38N6O6 — CID 173314777
[1-[5-(butylcarbamoylamino)-5-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]pentanoyl]piperidin-4-yl] acetate (PubChem CID 173314777) has the molecular formula C25H38N6O6 and a molecular weight of 518.62 g/mol. Its IUPAC name is [1-[5-(butylcarbamoylamino)-5-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]pentanoyl]piperidin-4-yl] acetate.
| Compound Name | [1-[5-(butylcarbamoylamino)-5-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]pentanoyl]piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 173314777 |
| Molecular Formula | C25H38N6O6 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | [1-[5-(butylcarbamoylamino)-5-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]pentanoyl]piperidin-4-yl] acetate |
| SMILES | CCCCNC(=O)NC(CCCC(=O)N1CCC(OC(C)=O)CC1)NC(=O)c1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C25H38N6O6/c1-3-4-14-27-25(35)29-21(28-24(34)19-10-8-18(9-11-19)23(26)30-36)6-5-7-22(33)31-15-12-20(13-16-31)37-17(2)32/h8-11,20-21,36H,3-7,12-16H2,1-2H3,(H2,26,30)(H,28,34)(H2,27,29,35) |
| InChIKey | DXDNZKUFADZYGW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 175.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|