C19H26N4O6 — CID 19691830
[1-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-3-oxopropanoyl]piperidin-4-yl] butaneperoxoate (PubChem CID 19691830) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is [1-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-3-oxopropanoyl]piperidin-4-yl] butaneperoxoate.
| Compound Name | [1-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-3-oxopropanoyl]piperidin-4-yl] butaneperoxoate |
|---|---|
| PubChem CID | 19691830 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [1-[3-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-3-oxopropanoyl]piperidin-4-yl] butaneperoxoate |
| SMILES | CCCC(=O)OOC1CCN(C(=O)CC(=O)Nc2ccc(/C(N)=N/O)cc2)CC1 |
| InChI | InChI=1S/C19H26N4O6/c1-2-3-18(26)29-28-15-8-10-23(11-9-15)17(25)12-16(24)21-14-6-4-13(5-7-14)19(20)22-27/h4-7,15,27H,2-3,8-12H2,1H3,(H2,20,22)(H,21,24) |
| InChIKey | VIRIJCKXCJVFEA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|