C24H28N4O6 — CID 173315077
[1-[3-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]-3-(4-hydroxyphenyl)propanoyl]piperidin-4-yl] acetate (PubChem CID 173315077) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is [1-[3-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]-3-(4-hydroxyphenyl)propanoyl]piperidin-4-yl] acetate.
| Compound Name | [1-[3-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]-3-(4-hydroxyphenyl)propanoyl]piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 173315077 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [1-[3-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]-3-(4-hydroxyphenyl)propanoyl]piperidin-4-yl] acetate |
| SMILES | CC(=O)OC1CCN(C(=O)CC(NC(=O)c2ccc(C(N)=NO)cc2)c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C24H28N4O6/c1-15(29)34-20-10-12-28(13-11-20)22(31)14-21(16-6-8-19(30)9-7-16)26-24(32)18-4-2-17(3-5-18)23(25)27-33/h2-9,20-21,30,33H,10-14H2,1H3,(H2,25,27)(H,26,32) |
| InChIKey | NBAKQSGWTAQETL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 154.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|