C21H25N5O6S — CID 155107173
(2S)-2-[[[4-[4-(diaminomethylideneamino)benzoyl]oxy-3-methylphenyl]methylamino]sulfanyl-methylamino]butanedioic acid (PubChem CID 155107173) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is (2S)-2-[[[4-[4-(diaminomethylideneamino)benzoyl]oxy-3-methylphenyl]methylamino]sulfanyl-methylamino]butanedioic acid.
| Compound Name | (2S)-2-[[[4-[4-(diaminomethylideneamino)benzoyl]oxy-3-methylphenyl]methylamino]sulfanyl-methylamino]butanedioic acid |
|---|---|
| PubChem CID | 155107173 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (2S)-2-[[[4-[4-(diaminomethylideneamino)benzoyl]oxy-3-methylphenyl]methylamino]sulfanyl-methylamino]butanedioic acid |
| SMILES | Cc1cc(CNSN(C)[C@@H](CC(=O)O)C(=O)O)ccc1OC(=O)c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C21H25N5O6S/c1-12-9-13(11-24-33-26(2)16(19(29)30)10-18(27)28)3-8-17(12)32-20(31)14-4-6-15(7-5-14)25-21(22)23/h3-9,16,24H,10-11H2,1-2H3,(H,27,28)(H,29,30)(H4,22,23,25)/t16-/m0/s1 |
| InChIKey | SEWXZSIMANVYSV-INIZCTEOSA-N |
| XLogP | 1.63 |
| TPSA | 180.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|