C32H28N2O7 — CID 71488717
2-[(4-benzoyloxyphenyl)methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid (PubChem CID 71488717) has the molecular formula C32H28N2O7 and a molecular weight of 552.58 g/mol. Its IUPAC name is 2-[(4-benzoyloxyphenyl)methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[(4-benzoyloxyphenyl)methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 71488717 |
| Molecular Formula | C32H28N2O7 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 2-[(4-benzoyloxyphenyl)methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)N(CC(=O)O)Cc3ccc(OC(=O)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H28N2O7/c1-40-27-15-7-22(8-16-27)19-29(35)33-26-13-11-24(12-14-26)31(38)34(21-30(36)37)20-23-9-17-28(18-10-23)41-32(39)25-5-3-2-4-6-25/h2-18H,19-21H2,1H3,(H,33,35)(H,36,37) |
| InChIKey | DUIAJQVJGFWRED-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|