C35H32Cl2N2O8 — CID 71488792
2-[[4-(3,5-dichloro-4-propoxybenzoyl)oxyphenyl]methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid (PubChem CID 71488792) has the molecular formula C35H32Cl2N2O8 and a molecular weight of 679.55 g/mol. Its IUPAC name is 2-[[4-(3,5-dichloro-4-propoxybenzoyl)oxyphenyl]methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(3,5-dichloro-4-propoxybenzoyl)oxyphenyl]methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 71488792 |
| Molecular Formula | C35H32Cl2N2O8 |
| Molecular Weight | 679.55 g/mol |
| Exact Mass | 678.15 |
| IUPAC Name | 2-[[4-(3,5-dichloro-4-propoxybenzoyl)oxyphenyl]methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid |
| SMILES | CCCOc1c(Cl)cc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)Cc4ccc(OC)cc4)cc3)cc2)cc1Cl |
| InChI | InChI=1S/C35H32Cl2N2O8/c1-3-16-46-33-29(36)18-25(19-30(33)37)35(44)47-28-14-6-23(7-15-28)20-39(21-32(41)42)34(43)24-8-10-26(11-9-24)38-31(40)17-22-4-12-27(45-2)13-5-22/h4-15,18-19H,3,16-17,20-21H2,1-2H3,(H,38,40)(H,41,42) |
| InChIKey | ZMLWGVBSWCNUNX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|