C34H32N2O8 — CID 89284788
2-[[4-(4-ethoxybenzoyl)oxyphenyl]methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid (PubChem CID 89284788) has the molecular formula C34H32N2O8 and a molecular weight of 596.64 g/mol. Its IUPAC name is 2-[[4-(4-ethoxybenzoyl)oxyphenyl]methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(4-ethoxybenzoyl)oxyphenyl]methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 89284788 |
| Molecular Formula | C34H32N2O8 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 2-[[4-(4-ethoxybenzoyl)oxyphenyl]methyl-[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]amino]acetic acid |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)Cc4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H32N2O8/c1-3-43-29-18-10-26(11-19-29)34(41)44-30-16-6-24(7-17-30)21-36(22-32(38)39)33(40)25-8-12-27(13-9-25)35-31(37)20-23-4-14-28(42-2)15-5-23/h4-19H,3,20-22H2,1-2H3,(H,35,37)(H,38,39) |
| InChIKey | IFTWWPAJAXINBG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|