C40H45N3O7 — CID 89285168
2-[[4-[[2-[4-(dimethylamino)phenyl]acetyl]amino]benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid (PubChem CID 89285168) has the molecular formula C40H45N3O7 and a molecular weight of 679.81 g/mol. Its IUPAC name is 2-[[4-[[2-[4-(dimethylamino)phenyl]acetyl]amino]benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[4-[[2-[4-(dimethylamino)phenyl]acetyl]amino]benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 89285168 |
| Molecular Formula | C40H45N3O7 |
| Molecular Weight | 679.81 g/mol |
| Exact Mass | 679.33 |
| IUPAC Name | 2-[[4-[[2-[4-(dimethylamino)phenyl]acetyl]amino]benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)Cc4ccc(N(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H45N3O7/c1-4-5-6-7-8-25-49-35-23-15-32(16-24-35)40(48)50-36-21-11-30(12-22-36)27-43(28-38(45)46)39(47)31-13-17-33(18-14-31)41-37(44)26-29-9-19-34(20-10-29)42(2)3/h9-24H,4-8,25-28H2,1-3H3,(H,41,44)(H,45,46) |
| InChIKey | ZYTILAMOTWKLKJ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.81 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|