C38H37F3N2O7 — CID 89285076
2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[3-(trifluoromethyl)benzoyl]amino]benzoyl]amino]acetic acid (PubChem CID 89285076) has the molecular formula C38H37F3N2O7 and a molecular weight of 690.72 g/mol. Its IUPAC name is 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[3-(trifluoromethyl)benzoyl]amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[3-(trifluoromethyl)benzoyl]amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 89285076 |
| Molecular Formula | C38H37F3N2O7 |
| Molecular Weight | 690.72 g/mol |
| Exact Mass | 690.26 |
| IUPAC Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[3-(trifluoromethyl)benzoyl]amino]benzoyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)c4cccc(C(F)(F)F)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H37F3N2O7/c1-2-3-4-5-6-22-49-32-20-14-28(15-21-32)37(48)50-33-18-10-26(11-19-33)24-43(25-34(44)45)36(47)27-12-16-31(17-13-27)42-35(46)29-8-7-9-30(23-29)38(39,40)41/h7-21,23H,2-6,22,24-25H2,1H3,(H,42,46)(H,44,45) |
| InChIKey | CKOHGOMCSNMXOV-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.72 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|