C35H38N2O8 — CID 89285012
2-[[4-(2,3-dihydrofuran-2-carbonylamino)benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid (PubChem CID 89285012) has the molecular formula C35H38N2O8 and a molecular weight of 614.70 g/mol. Its IUPAC name is 2-[[4-(2,3-dihydrofuran-2-carbonylamino)benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[4-(2,3-dihydrofuran-2-carbonylamino)benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 89285012 |
| Molecular Formula | C35H38N2O8 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 2-[[4-(2,3-dihydrofuran-2-carbonylamino)benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)C4CC=CO4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O8/c1-2-3-4-5-6-21-43-29-19-13-27(14-20-29)35(42)45-30-17-9-25(10-18-30)23-37(24-32(38)39)34(41)26-11-15-28(16-12-26)36-33(40)31-8-7-22-44-31/h7,9-20,22,31H,2-6,8,21,23-24H2,1H3,(H,36,40)(H,38,39) |
| InChIKey | UDEVAUZNKCXMDQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|