C41H46N2O8 — CID 71488647
2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]-[[4-(4-nonoxybenzoyl)oxyphenyl]methyl]amino]acetic acid (PubChem CID 71488647) has the molecular formula C41H46N2O8 and a molecular weight of 694.83 g/mol. Its IUPAC name is 2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]-[[4-(4-nonoxybenzoyl)oxyphenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]-[[4-(4-nonoxybenzoyl)oxyphenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 71488647 |
| Molecular Formula | C41H46N2O8 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | 2-[[4-[[2-(4-methoxyphenyl)acetyl]amino]benzoyl]-[[4-(4-nonoxybenzoyl)oxyphenyl]methyl]amino]acetic acid |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)Cc4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H46N2O8/c1-3-4-5-6-7-8-9-26-50-36-24-16-33(17-25-36)41(48)51-37-22-12-31(13-23-37)28-43(29-39(45)46)40(47)32-14-18-34(19-15-32)42-38(44)27-30-10-20-35(49-2)21-11-30/h10-25H,3-9,26-29H2,1-2H3,(H,42,44)(H,45,46) |
| InChIKey | CDAKEGHTGXAOPN-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|