C43H52N2O7 — CID 130210156
[4-[[[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]phenyl] 4-heptoxybenzoate (PubChem CID 130210156) has the molecular formula C43H52N2O7 and a molecular weight of 708.90 g/mol. Its IUPAC name is [4-[[[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]phenyl] 4-heptoxybenzoate.
| Compound Name | [4-[[[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]phenyl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 130210156 |
| Molecular Formula | C43H52N2O7 |
| Molecular Weight | 708.90 g/mol |
| Exact Mass | 708.38 |
| IUPAC Name | [4-[[[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]phenyl] 4-heptoxybenzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)OC(C)(C)C)Cc3ccc(NC(=O)Cc4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H52N2O7/c1-6-7-8-9-10-27-50-38-25-17-35(18-26-38)42(48)51-39-23-15-34(16-24-39)30-45(31-41(47)52-43(2,3)4)29-33-11-19-36(20-12-33)44-40(46)28-32-13-21-37(49-5)22-14-32/h11-26H,6-10,27-31H2,1-5H3,(H,44,46) |
| InChIKey | JSFVRYVUIXBQFF-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.90 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|