C40H41F3N2O9 — CID 89284779
2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[2-methoxy-4-(trifluoromethoxy)phenyl]acetyl]amino]benzoyl]amino]acetic acid (PubChem CID 89284779) has the molecular formula C40H41F3N2O9 and a molecular weight of 750.77 g/mol. Its IUPAC name is 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[2-methoxy-4-(trifluoromethoxy)phenyl]acetyl]amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[2-methoxy-4-(trifluoromethoxy)phenyl]acetyl]amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 89284779 |
| Molecular Formula | C40H41F3N2O9 |
| Molecular Weight | 750.77 g/mol |
| Exact Mass | 750.28 |
| IUPAC Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[2-methoxy-4-(trifluoromethoxy)phenyl]acetyl]amino]benzoyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)Cc4ccc(OC(F)(F)F)cc4OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H41F3N2O9/c1-3-4-5-6-7-22-52-32-19-12-29(13-20-32)39(50)53-33-17-8-27(9-18-33)25-45(26-37(47)48)38(49)28-10-15-31(16-11-28)44-36(46)23-30-14-21-34(24-35(30)51-2)54-40(41,42)43/h8-21,24H,3-7,22-23,25-26H2,1-2H3,(H,44,46)(H,47,48) |
| InChIKey | DCANNHMQTODDNM-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.77 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|