C45H43F3N2O8 — CID 89284777
4-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]amino]benzoic acid (PubChem CID 89284777) has the molecular formula C45H43F3N2O8 and a molecular weight of 796.84 g/mol. Its IUPAC name is 4-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]amino]benzoic acid.
| Compound Name | 4-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 89284777 |
| Molecular Formula | C45H43F3N2O8 |
| Molecular Weight | 796.84 g/mol |
| Exact Mass | 796.30 |
| IUPAC Name | 4-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]amino]benzoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(C(=O)c3ccc(NC(=O)Cc4ccc(OC)cc4C(F)(F)F)cc3)c3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H43F3N2O8/c1-3-4-5-6-7-26-57-37-23-14-33(15-24-37)44(55)58-38-21-8-30(9-22-38)29-50(36-19-12-32(13-20-36)43(53)54)42(52)31-10-17-35(18-11-31)49-41(51)27-34-16-25-39(56-2)28-40(34)45(46,47)48/h8-25,28H,3-7,26-27,29H2,1-2H3,(H,49,51)(H,53,54) |
| InChIKey | GUPOVSUXWJLCME-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.84 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|