C39H43NO6 — CID 89284851
4-[(4-tert-butylbenzoyl)-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]benzoic acid (PubChem CID 89284851) has the molecular formula C39H43NO6 and a molecular weight of 621.77 g/mol. Its IUPAC name is 4-[(4-tert-butylbenzoyl)-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]benzoic acid.
| Compound Name | 4-[(4-tert-butylbenzoyl)-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 89284851 |
| Molecular Formula | C39H43NO6 |
| Molecular Weight | 621.77 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | 4-[(4-tert-butylbenzoyl)-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]benzoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(C(=O)c3ccc(C(C)(C)C)cc3)c3ccc(C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H43NO6/c1-5-6-7-8-9-26-45-34-24-16-31(17-25-34)38(44)46-35-22-10-28(11-23-35)27-40(33-20-14-30(15-21-33)37(42)43)36(41)29-12-18-32(19-13-29)39(2,3)4/h10-25H,5-9,26-27H2,1-4H3,(H,42,43) |
| InChIKey | IDJYJKAGPJDYBC-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.77 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|