C40H40F4N2O8 — CID 89284928
2-[[2-fluoro-4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid (PubChem CID 89284928) has the molecular formula C40H40F4N2O8 and a molecular weight of 752.76 g/mol. Its IUPAC name is 2-[[2-fluoro-4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid.
| Compound Name | 2-[[2-fluoro-4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 89284928 |
| Molecular Formula | C40H40F4N2O8 |
| Molecular Weight | 752.76 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | 2-[[2-fluoro-4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]benzoyl]-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)Cc4ccc(OC)cc4C(F)(F)F)cc3F)cc2)cc1 |
| InChI | InChI=1S/C40H40F4N2O8/c1-3-4-5-6-7-20-53-30-16-10-27(11-17-30)39(51)54-31-14-8-26(9-15-31)24-46(25-37(48)49)38(50)33-19-13-29(22-35(33)41)45-36(47)21-28-12-18-32(52-2)23-34(28)40(42,43)44/h8-19,22-23H,3-7,20-21,24-25H2,1-2H3,(H,45,47)(H,48,49) |
| InChIKey | OEHKDZXVQFPGAT-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.76 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|