C39H40F3N3O8 — CID 89284890
2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[5-[[4-methoxy-2-(trifluoromethyl)phenyl]methylcarbamoyl]pyridine-2-carbonyl]amino]acetic acid (PubChem CID 89284890) has the molecular formula C39H40F3N3O8 and a molecular weight of 735.76 g/mol. Its IUPAC name is 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[5-[[4-methoxy-2-(trifluoromethyl)phenyl]methylcarbamoyl]pyridine-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[5-[[4-methoxy-2-(trifluoromethyl)phenyl]methylcarbamoyl]pyridine-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 89284890 |
| Molecular Formula | C39H40F3N3O8 |
| Molecular Weight | 735.76 g/mol |
| Exact Mass | 735.28 |
| IUPAC Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[5-[[4-methoxy-2-(trifluoromethyl)phenyl]methylcarbamoyl]pyridine-2-carbonyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(C(=O)NCc4ccc(OC)cc4C(F)(F)F)cn3)cc2)cc1 |
| InChI | InChI=1S/C39H40F3N3O8/c1-3-4-5-6-7-20-52-30-16-10-27(11-17-30)38(50)53-31-14-8-26(9-15-31)24-45(25-35(46)47)37(49)34-19-13-29(23-43-34)36(48)44-22-28-12-18-32(51-2)21-33(28)39(40,41)42/h8-19,21,23H,3-7,20,22,24-25H2,1-2H3,(H,44,48)(H,46,47) |
| InChIKey | JWMGZXNANDEQOD-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 144.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.76 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|