C38H40N2O9 — CID 89285069
2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[(4-methoxyphenoxy)carbonylamino]benzoyl]amino]acetic acid (PubChem CID 89285069) has the molecular formula C38H40N2O9 and a molecular weight of 668.74 g/mol. Its IUPAC name is 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[(4-methoxyphenoxy)carbonylamino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[(4-methoxyphenoxy)carbonylamino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 89285069 |
| Molecular Formula | C38H40N2O9 |
| Molecular Weight | 668.74 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[(4-methoxyphenoxy)carbonylamino]benzoyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)Oc4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H40N2O9/c1-3-4-5-6-7-24-47-32-18-12-29(13-19-32)37(44)48-33-16-8-27(9-17-33)25-40(26-35(41)42)36(43)28-10-14-30(15-11-28)39-38(45)49-34-22-20-31(46-2)21-23-34/h8-23H,3-7,24-26H2,1-2H3,(H,39,45)(H,41,42) |
| InChIKey | NOOCADUVYSAFNI-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.74 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|