C33H38N2O8 — CID 71488904
2-[[2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-(4-methoxybenzoyl)amino]acetyl]amino]acetic acid (PubChem CID 71488904) has the molecular formula C33H38N2O8 and a molecular weight of 590.67 g/mol. Its IUPAC name is 2-[[2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-(4-methoxybenzoyl)amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-(4-methoxybenzoyl)amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 71488904 |
| Molecular Formula | C33H38N2O8 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 2-[[2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-(4-methoxybenzoyl)amino]acetyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)NCC(=O)O)C(=O)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H38N2O8/c1-3-4-5-6-7-20-42-28-18-12-26(13-19-28)33(40)43-29-14-8-24(9-15-29)22-35(23-30(36)34-21-31(37)38)32(39)25-10-16-27(41-2)17-11-25/h8-19H,3-7,20-23H2,1-2H3,(H,34,36)(H,37,38) |
| InChIKey | CYOAGDZFCJTEJR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|