C43H47F3N2O9 — CID 89284933
2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]-2-propan-2-yloxybenzoyl]amino]acetic acid (PubChem CID 89284933) has the molecular formula C43H47F3N2O9 and a molecular weight of 792.85 g/mol. Its IUPAC name is 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]-2-propan-2-yloxybenzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]-2-propan-2-yloxybenzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 89284933 |
| Molecular Formula | C43H47F3N2O9 |
| Molecular Weight | 792.85 g/mol |
| Exact Mass | 792.32 |
| IUPAC Name | 2-[[4-(4-heptoxybenzoyl)oxyphenyl]methyl-[4-[[2-[4-methoxy-2-(trifluoromethyl)phenyl]acetyl]amino]-2-propan-2-yloxybenzoyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CN(CC(=O)O)C(=O)c3ccc(NC(=O)Cc4ccc(OC)cc4C(F)(F)F)cc3OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C43H47F3N2O9/c1-5-6-7-8-9-22-55-33-18-12-30(13-19-33)42(53)57-34-16-10-29(11-17-34)26-48(27-40(50)51)41(52)36-21-15-32(24-38(36)56-28(2)3)47-39(49)23-31-14-20-35(54-4)25-37(31)43(44,45)46/h10-21,24-25,28H,5-9,22-23,26-27H2,1-4H3,(H,47,49)(H,50,51) |
| InChIKey | QABPTNGWOGRYGJ-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.85 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|