C40H44N2O9 — CID 58545778
(2S)-2-[[4-[[2-(2,4-dimethoxyphenyl)acetyl]amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid (PubChem CID 58545778) has the molecular formula C40H44N2O9 and a molecular weight of 696.80 g/mol. Its IUPAC name is (2S)-2-[[4-[[2-(2,4-dimethoxyphenyl)acetyl]amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[[4-[[2-(2,4-dimethoxyphenyl)acetyl]amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 58545778 |
| Molecular Formula | C40H44N2O9 |
| Molecular Weight | 696.80 g/mol |
| Exact Mass | 696.30 |
| IUPAC Name | (2S)-2-[[4-[[2-(2,4-dimethoxyphenyl)acetyl]amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)Cc4ccc(OC)cc4OC)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C40H44N2O9/c1-4-5-6-7-8-23-50-32-20-13-29(14-21-32)40(47)51-33-18-9-27(10-19-33)24-35(39(45)46)42-38(44)28-11-16-31(17-12-28)41-37(43)25-30-15-22-34(48-2)26-36(30)49-3/h9-22,26,35H,4-8,23-25H2,1-3H3,(H,41,43)(H,42,44)(H,45,46)/t35-/m0/s1 |
| InChIKey | VLGKNZNQEWOQPB-DHUJRADRSA-N |
| XLogP | 6.88 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.80 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|