C36H38N2O7S — CID 54765072
(2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(2-thiophen-3-ylacetyl)amino]benzoyl]amino]propanoic acid (PubChem CID 54765072) has the molecular formula C36H38N2O7S and a molecular weight of 642.77 g/mol. Its IUPAC name is (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(2-thiophen-3-ylacetyl)amino]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(2-thiophen-3-ylacetyl)amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54765072 |
| Molecular Formula | C36H38N2O7S |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[(2-thiophen-3-ylacetyl)amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)Cc4ccsc4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C36H38N2O7S/c1-2-3-4-5-6-20-44-30-17-11-28(12-18-30)36(43)45-31-15-7-25(8-16-31)22-32(35(41)42)38-34(40)27-9-13-29(14-10-27)37-33(39)23-26-19-21-46-24-26/h7-19,21,24,32H,2-6,20,22-23H2,1H3,(H,37,39)(H,38,40)(H,41,42)/t32-/m0/s1 |
| InChIKey | WQYGSVFXHMJGIC-YTTGMZPUSA-N |
| XLogP | 6.92 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|