C45H46N2O8 — CID 54765154
(2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[[2-(4-phenylmethoxyphenyl)acetyl]amino]benzoyl]amino]propanoic acid (PubChem CID 54765154) has the molecular formula C45H46N2O8 and a molecular weight of 742.87 g/mol. Its IUPAC name is (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[[2-(4-phenylmethoxyphenyl)acetyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[[2-(4-phenylmethoxyphenyl)acetyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54765154 |
| Molecular Formula | C45H46N2O8 |
| Molecular Weight | 742.87 g/mol |
| Exact Mass | 742.33 |
| IUPAC Name | (2S)-3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[[2-(4-phenylmethoxyphenyl)acetyl]amino]benzoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)Cc4ccc(OCc5ccccc5)cc4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C45H46N2O8/c1-2-3-4-5-9-28-53-38-26-18-36(19-27-38)45(52)55-40-24-14-32(15-25-40)29-41(44(50)51)47-43(49)35-16-20-37(21-17-35)46-42(48)30-33-12-22-39(23-13-33)54-31-34-10-7-6-8-11-34/h6-8,10-27,41H,2-5,9,28-31H2,1H3,(H,46,48)(H,47,49)(H,50,51)/t41-/m0/s1 |
| InChIKey | ACIKHINVAHVDRR-RWYGWLOXSA-N |
| XLogP | 8.44 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.87 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|