C38H38F2N2O7 — CID 58545596
(2S)-2-[[4-[[2-(2,3-difluorophenyl)acetyl]amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid (PubChem CID 58545596) has the molecular formula C38H38F2N2O7 and a molecular weight of 672.73 g/mol. Its IUPAC name is (2S)-2-[[4-[[2-(2,3-difluorophenyl)acetyl]amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[[4-[[2-(2,3-difluorophenyl)acetyl]amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 58545596 |
| Molecular Formula | C38H38F2N2O7 |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.26 |
| IUPAC Name | (2S)-2-[[4-[[2-(2,3-difluorophenyl)acetyl]amino]benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)Cc4cccc(F)c4F)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C38H38F2N2O7/c1-2-3-4-5-6-22-48-30-20-14-27(15-21-30)38(47)49-31-18-10-25(11-19-31)23-33(37(45)46)42-36(44)26-12-16-29(17-13-26)41-34(43)24-28-8-7-9-32(39)35(28)40/h7-21,33H,2-6,22-24H2,1H3,(H,41,43)(H,42,44)(H,45,46)/t33-/m0/s1 |
| InChIKey | KSUSYZSWZVAMMQ-XIFFEERXSA-N |
| XLogP | 7.14 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|