C39H42N2O7 — CID 76819125
3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-(2-phenylpropanoylamino)benzoyl]amino]propanoic acid (PubChem CID 76819125) has the molecular formula C39H42N2O7 and a molecular weight of 650.77 g/mol. Its IUPAC name is 3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-(2-phenylpropanoylamino)benzoyl]amino]propanoic acid.
| Compound Name | 3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-(2-phenylpropanoylamino)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 76819125 |
| Molecular Formula | C39H42N2O7 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | 3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-(2-phenylpropanoylamino)benzoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(CC(NC(=O)c3ccc(NC(=O)C(C)c4ccccc4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C39H42N2O7/c1-3-4-5-6-10-25-47-33-23-17-31(18-24-33)39(46)48-34-21-13-28(14-22-34)26-35(38(44)45)41-37(43)30-15-19-32(20-16-30)40-36(42)27(2)29-11-8-7-9-12-29/h7-9,11-24,27,35H,3-6,10,25-26H2,1-2H3,(H,40,42)(H,41,43)(H,44,45) |
| InChIKey | GWUUMULGBUMHNH-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|