C37H42N2O7S — CID 123662916
3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[3-(methylsulfanylmethylidene)pent-4-enoylamino]benzoyl]amino]propanoic acid (PubChem CID 123662916) has the molecular formula C37H42N2O7S and a molecular weight of 658.82 g/mol. Its IUPAC name is 3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[3-(methylsulfanylmethylidene)pent-4-enoylamino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[3-(methylsulfanylmethylidene)pent-4-enoylamino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 123662916 |
| Molecular Formula | C37H42N2O7S |
| Molecular Weight | 658.82 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 3-[4-(4-heptoxybenzoyl)oxyphenyl]-2-[[4-[3-(methylsulfanylmethylidene)pent-4-enoylamino]benzoyl]amino]propanoic acid |
| SMILES | C=CC(=CSC)CC(=O)Nc1ccc(C(=O)NC(Cc2ccc(OC(=O)c3ccc(OCCCCCCC)cc3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C37H42N2O7S/c1-4-6-7-8-9-22-45-31-20-14-29(15-21-31)37(44)46-32-18-10-27(11-19-32)23-33(36(42)43)39-35(41)28-12-16-30(17-13-28)38-34(40)24-26(5-2)25-47-3/h5,10-21,25,33H,2,4,6-9,22-24H2,1,3H3,(H,38,40)(H,39,41)(H,42,43) |
| InChIKey | XWYCKEYUAQJYPZ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.82 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|