C34H38N2O7 — CID 58545669
(2S)-2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid (PubChem CID 58545669) has the molecular formula C34H38N2O7 and a molecular weight of 586.69 g/mol. Its IUPAC name is (2S)-2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 58545669 |
| Molecular Formula | C34H38N2O7 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | (2S)-2-[[4-(cyclopropanecarbonylamino)benzoyl]amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)C4CC4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H38N2O7/c1-2-3-4-5-6-21-42-28-19-13-26(14-20-28)34(41)43-29-17-7-23(8-18-29)22-30(33(39)40)36-32(38)25-11-15-27(16-12-25)35-31(37)24-9-10-24/h7-8,11-20,24,30H,2-6,9-10,21-22H2,1H3,(H,35,37)(H,36,38)(H,39,40)/t30-/m0/s1 |
| InChIKey | DNQYNKYNTMLWAA-PMERELPUSA-N |
| XLogP | 6.03 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|