C35H43N3O7S — CID 58545899
(2S)-2-[[4-(cyclopentanecarbonylamino)benzoyl]amino]-3-[4-[(4-heptoxyphenyl)sulfonylamino]phenyl]propanoic acid (PubChem CID 58545899) has the molecular formula C35H43N3O7S and a molecular weight of 649.81 g/mol. Its IUPAC name is (2S)-2-[[4-(cyclopentanecarbonylamino)benzoyl]amino]-3-[4-[(4-heptoxyphenyl)sulfonylamino]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[4-(cyclopentanecarbonylamino)benzoyl]amino]-3-[4-[(4-heptoxyphenyl)sulfonylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 58545899 |
| Molecular Formula | C35H43N3O7S |
| Molecular Weight | 649.81 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | (2S)-2-[[4-(cyclopentanecarbonylamino)benzoyl]amino]-3-[4-[(4-heptoxyphenyl)sulfonylamino]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(S(=O)(=O)Nc2ccc(C[C@H](NC(=O)c3ccc(NC(=O)C4CCCC4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C35H43N3O7S/c1-2-3-4-5-8-23-45-30-19-21-31(22-20-30)46(43,44)38-29-15-11-25(12-16-29)24-32(35(41)42)37-34(40)27-13-17-28(18-14-27)36-33(39)26-9-6-7-10-26/h11-22,26,32,38H,2-10,23-24H2,1H3,(H,36,39)(H,37,40)(H,41,42)/t32-/m0/s1 |
| InChIKey | PHQGGIGHCJVYLZ-YTTGMZPUSA-N |
| XLogP | 6.39 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.81 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|