C35H41NO7 — CID 54764375
(2S)-2-[(4-cyclopentyloxybenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid (PubChem CID 54764375) has the molecular formula C35H41NO7 and a molecular weight of 587.71 g/mol. Its IUPAC name is (2S)-2-[(4-cyclopentyloxybenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[(4-cyclopentyloxybenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 54764375 |
| Molecular Formula | C35H41NO7 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | (2S)-2-[(4-cyclopentyloxybenzoyl)amino]-3-[4-(4-heptoxybenzoyl)oxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(C(=O)Oc2ccc(C[C@H](NC(=O)c3ccc(OC4CCCC4)cc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C35H41NO7/c1-2-3-4-5-8-23-41-28-19-15-27(16-20-28)35(40)43-31-17-11-25(12-18-31)24-32(34(38)39)36-33(37)26-13-21-30(22-14-26)42-29-9-6-7-10-29/h11-22,29,32H,2-10,23-24H2,1H3,(H,36,37)(H,38,39)/t32-/m0/s1 |
| InChIKey | RGKVQYLHSHSMIC-YTTGMZPUSA-N |
| XLogP | 7.00 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|